C23H37N3O5S — CID 74012259
N-hydroxy-2-[4-methyl-1-[2-(2-methylpropyl)-2-methylsulfonylhydrazinyl]-1-oxopentan-2-yl]-6-phenylhex-4-enamide (PubChem CID 74012259) has the molecular formula C23H37N3O5S and a molecular weight of 467.63 g/mol. Its IUPAC name is N-hydroxy-2-[4-methyl-1-[2-(2-methylpropyl)-2-methylsulfonylhydrazinyl]-1-oxopentan-2-yl]-6-phenylhex-4-enamide.
| Compound Name | N-hydroxy-2-[4-methyl-1-[2-(2-methylpropyl)-2-methylsulfonylhydrazinyl]-1-oxopentan-2-yl]-6-phenylhex-4-enamide |
|---|---|
| PubChem CID | 74012259 |
| Molecular Formula | C23H37N3O5S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-hydroxy-2-[4-methyl-1-[2-(2-methylpropyl)-2-methylsulfonylhydrazinyl]-1-oxopentan-2-yl]-6-phenylhex-4-enamide |
| SMILES | CC(C)CC(C(=O)NN(CC(C)C)S(C)(=O)=O)C(CC=CCc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C23H37N3O5S/c1-17(2)15-21(22(27)24-26(16-18(3)4)32(5,30)31)20(23(28)25-29)14-10-9-13-19-11-7-6-8-12-19/h6-12,17-18,20-21,29H,13-16H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | HVKCMVUKKVQBMK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|