C28H48N4O5S — CID 86757190
(2S,3R)-3-[[3-(diethylamino)propylsulfonyl-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanamide (PubChem CID 86757190) has the molecular formula C28H48N4O5S and a molecular weight of 552.78 g/mol. Its IUPAC name is (2S,3R)-3-[[3-(diethylamino)propylsulfonyl-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanamide.
| Compound Name | (2S,3R)-3-[[3-(diethylamino)propylsulfonyl-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 86757190 |
| Molecular Formula | C28H48N4O5S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (2S,3R)-3-[[3-(diethylamino)propylsulfonyl-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-[(E)-3-phenylprop-2-enyl]hexanamide |
| SMILES | CCN(CC)CCCS(=O)(=O)N(CC(C)C)NC(=O)[C@H](CC(C)C)[C@H](C/C=C/c1ccccc1)C(=O)NO |
| InChI | InChI=1S/C28H48N4O5S/c1-7-31(8-2)18-13-19-38(36,37)32(21-23(5)6)29-27(33)26(20-22(3)4)25(28(34)30-35)17-12-16-24-14-10-9-11-15-24/h9-12,14-16,22-23,25-26,35H,7-8,13,17-21H2,1-6H3,(H,29,33)(H,30,34)/b16-12+/t25-,26+/m0/s1 |
| InChIKey | YSIPJMKYEZKXDW-JVNWAFCKSA-N |
| XLogP | 3.92 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|