C23H36N4O4 — CID 173233043
(2S)-2-[(2R)-1-[2-[(2R)-2-aminopropanoyl]-2-(2-methylpropyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-N-hydroxy-5-phenylpent-4-enamide (PubChem CID 173233043) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is (2S)-2-[(2R)-1-[2-[(2R)-2-aminopropanoyl]-2-(2-methylpropyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-N-hydroxy-5-phenylpent-4-enamide.
| Compound Name | (2S)-2-[(2R)-1-[2-[(2R)-2-aminopropanoyl]-2-(2-methylpropyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-N-hydroxy-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 173233043 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (2S)-2-[(2R)-1-[2-[(2R)-2-aminopropanoyl]-2-(2-methylpropyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-N-hydroxy-5-phenylpent-4-enamide |
| SMILES | CC(C)CN(NC(=O)[C@H](C(C)C)[C@H](CC=Cc1ccccc1)C(=O)NO)C(=O)[C@@H](C)N |
| InChI | InChI=1S/C23H36N4O4/c1-15(2)14-27(23(30)17(5)24)25-22(29)20(16(3)4)19(21(28)26-31)13-9-12-18-10-7-6-8-11-18/h6-12,15-17,19-20,31H,13-14,24H2,1-5H3,(H,25,29)(H,26,28)/t17-,19+,20-/m1/s1 |
| InChIKey | YOBYUIJRUUPZDV-YZGWKJHDSA-N |
| XLogP | 2.35 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|