C26H40N4O6 — CID 91046965
(4R)-4-amino-5-[[[(2S)-1-(hydroxyamino)-1-oxo-5-phenylpent-4-en-2-yl]-(4-methylpentanoyl)amino]-(2-methylpropyl)amino]-5-oxopentanoic acid (PubChem CID 91046965) has the molecular formula C26H40N4O6 and a molecular weight of 504.63 g/mol. Its IUPAC name is (4R)-4-amino-5-[[[(2S)-1-(hydroxyamino)-1-oxo-5-phenylpent-4-en-2-yl]-(4-methylpentanoyl)amino]-(2-methylpropyl)amino]-5-oxopentanoic acid.
| Compound Name | (4R)-4-amino-5-[[[(2S)-1-(hydroxyamino)-1-oxo-5-phenylpent-4-en-2-yl]-(4-methylpentanoyl)amino]-(2-methylpropyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91046965 |
| Molecular Formula | C26H40N4O6 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | (4R)-4-amino-5-[[[(2S)-1-(hydroxyamino)-1-oxo-5-phenylpent-4-en-2-yl]-(4-methylpentanoyl)amino]-(2-methylpropyl)amino]-5-oxopentanoic acid |
| SMILES | CC(C)CCC(=O)N([C@@H](CC=Cc1ccccc1)C(=O)NO)N(CC(C)C)C(=O)[C@H](N)CCC(=O)O |
| InChI | InChI=1S/C26H40N4O6/c1-18(2)13-15-23(31)30(29(17-19(3)4)26(35)21(27)14-16-24(32)33)22(25(34)28-36)12-8-11-20-9-6-5-7-10-20/h5-11,18-19,21-22,36H,12-17,27H2,1-4H3,(H,28,34)(H,32,33)/t21-,22+/m1/s1 |
| InChIKey | KDYMEJYPHCFASV-YADHBBJMSA-N |
| XLogP | 2.82 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|