C30H46N4O6 — CID 90961848
(2S)-2-[[(2-acetamidoacetyl)-(2-methylpropyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxy-5-phenylpent-4-enamide (PubChem CID 90961848) has the molecular formula C30H46N4O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is (2S)-2-[[(2-acetamidoacetyl)-(2-methylpropyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxy-5-phenylpent-4-enamide.
| Compound Name | (2S)-2-[[(2-acetamidoacetyl)-(2-methylpropyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxy-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 90961848 |
| Molecular Formula | C30H46N4O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | (2S)-2-[[(2-acetamidoacetyl)-(2-methylpropyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxy-5-phenylpent-4-enamide |
| SMILES | CC(=O)NCC(=O)N(CC(C)C)N(C(=O)CCC(C)C)[C@@H](CC=Cc1ccccc1)C(=O)NO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C30H46N4O6/c1-22(2)17-18-27(36)34(33(21-23(3)4)28(37)20-31-24(5)35)26(15-11-14-25-12-7-6-8-13-25)30(38)32-40-29-16-9-10-19-39-29/h6-8,11-14,22-23,26,29H,9-10,15-21H2,1-5H3,(H,31,35)(H,32,38)/t26-,29+/m0/s1 |
| InChIKey | BVYPALVJRXRINF-LITSAYRRSA-N |
| XLogP | 3.83 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|