C25H38N4O4 — CID 90733333
(2S)-2-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]-(3-cyclobutylpropanoyl)amino]-N-hydroxy-5-phenylpent-4-enamide (PubChem CID 90733333) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is (2S)-2-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]-(3-cyclobutylpropanoyl)amino]-N-hydroxy-5-phenylpent-4-enamide.
| Compound Name | (2S)-2-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]-(3-cyclobutylpropanoyl)amino]-N-hydroxy-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 90733333 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (2S)-2-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]-(3-cyclobutylpropanoyl)amino]-N-hydroxy-5-phenylpent-4-enamide |
| SMILES | CC(C)CN(C(=O)[C@@H](C)N)N(C(=O)CCC1CCC1)[C@@H](CC=Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C25H38N4O4/c1-18(2)17-28(25(32)19(3)26)29(23(30)16-15-21-11-7-12-21)22(24(31)27-33)14-8-13-20-9-5-4-6-10-20/h4-6,8-10,13,18-19,21-22,33H,7,11-12,14-17,26H2,1-3H3,(H,27,31)/t19-,22+/m1/s1 |
| InChIKey | JSRCSFKFGCOQJF-KNQAVFIVSA-N |
| XLogP | 3.12 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|