C27H38N4O4 — CID 90818904
(2S)-N-hydroxy-2-[4-methylpentanoyl-[2-methylpropyl-(1-methylpyrrole-2-carbonyl)amino]amino]-5-phenylpent-4-enamide (PubChem CID 90818904) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[4-methylpentanoyl-[2-methylpropyl-(1-methylpyrrole-2-carbonyl)amino]amino]-5-phenylpent-4-enamide.
| Compound Name | (2S)-N-hydroxy-2-[4-methylpentanoyl-[2-methylpropyl-(1-methylpyrrole-2-carbonyl)amino]amino]-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 90818904 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (2S)-N-hydroxy-2-[4-methylpentanoyl-[2-methylpropyl-(1-methylpyrrole-2-carbonyl)amino]amino]-5-phenylpent-4-enamide |
| SMILES | CC(C)CCC(=O)N([C@@H](CC=Cc1ccccc1)C(=O)NO)N(CC(C)C)C(=O)c1cccn1C |
| InChI | InChI=1S/C27H38N4O4/c1-20(2)16-17-25(32)31(30(19-21(3)4)27(34)24-15-10-18-29(24)5)23(26(33)28-35)14-9-13-22-11-7-6-8-12-22/h6-13,15,18,20-21,23,35H,14,16-17,19H2,1-5H3,(H,28,33)/t23-/m0/s1 |
| InChIKey | ILAFZAJVUVZNST-QHCPKHFHSA-N |
| XLogP | 4.28 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|