C23H30N4O6S — CID 54132103
N-[(2R)-3-(hydroxyamino)-2-[4-methylpentanoyl-(N-methylsulfonylanilino)amino]-3-oxopropyl]benzamide (PubChem CID 54132103) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[(2R)-3-(hydroxyamino)-2-[4-methylpentanoyl-(N-methylsulfonylanilino)amino]-3-oxopropyl]benzamide.
| Compound Name | N-[(2R)-3-(hydroxyamino)-2-[4-methylpentanoyl-(N-methylsulfonylanilino)amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 54132103 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[(2R)-3-(hydroxyamino)-2-[4-methylpentanoyl-(N-methylsulfonylanilino)amino]-3-oxopropyl]benzamide |
| SMILES | CC(C)CCC(=O)N([C@H](CNC(=O)c1ccccc1)C(=O)NO)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H30N4O6S/c1-17(2)14-15-21(28)26(27(34(3,32)33)19-12-8-5-9-13-19)20(23(30)25-31)16-24-22(29)18-10-6-4-7-11-18/h4-13,17,20,31H,14-16H2,1-3H3,(H,24,29)(H,25,30)/t20-/m1/s1 |
| InChIKey | NVCDKSQJGSIEOZ-HXUWFJFHSA-N |
| XLogP | 1.94 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|