C28H42N6O4 — CID 91254744
tert-butyl (2S)-2-[4-methylpentanoyl-[2-methylpropyl-[2-(2H-tetrazol-5-yl)acetyl]amino]amino]-5-phenylpent-4-enoate (PubChem CID 91254744) has the molecular formula C28H42N6O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-methylpentanoyl-[2-methylpropyl-[2-(2H-tetrazol-5-yl)acetyl]amino]amino]-5-phenylpent-4-enoate.
| Compound Name | tert-butyl (2S)-2-[4-methylpentanoyl-[2-methylpropyl-[2-(2H-tetrazol-5-yl)acetyl]amino]amino]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 91254744 |
| Molecular Formula | C28H42N6O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | tert-butyl (2S)-2-[4-methylpentanoyl-[2-methylpropyl-[2-(2H-tetrazol-5-yl)acetyl]amino]amino]-5-phenylpent-4-enoate |
| SMILES | CC(C)CCC(=O)N([C@@H](CC=Cc1ccccc1)C(=O)OC(C)(C)C)N(CC(C)C)C(=O)Cc1nn[nH]n1 |
| InChI | InChI=1S/C28H42N6O4/c1-20(2)16-17-25(35)34(33(19-21(3)4)26(36)18-24-29-31-32-30-24)23(27(37)38-28(5,6)7)15-11-14-22-12-9-8-10-13-22/h8-14,20-21,23H,15-19H2,1-7H3,(H,29,30,31,32)/t23-/m0/s1 |
| InChIKey | MZHJIXFEWUWJFF-QHCPKHFHSA-N |
| XLogP | 4.22 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|