C27H42N2O3 — CID 91581791
tert-butyl (2S)-2-[3-cyclopentylpropanoyl-(2-methylpropylamino)amino]-5-phenylpent-4-enoate (PubChem CID 91581791) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-cyclopentylpropanoyl-(2-methylpropylamino)amino]-5-phenylpent-4-enoate.
| Compound Name | tert-butyl (2S)-2-[3-cyclopentylpropanoyl-(2-methylpropylamino)amino]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 91581791 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | tert-butyl (2S)-2-[3-cyclopentylpropanoyl-(2-methylpropylamino)amino]-5-phenylpent-4-enoate |
| SMILES | CC(C)CNN(C(=O)CCC1CCCC1)[C@@H](CC=Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H42N2O3/c1-21(2)20-28-29(25(30)19-18-23-14-9-10-15-23)24(26(31)32-27(3,4)5)17-11-16-22-12-7-6-8-13-22/h6-8,11-13,16,21,23-24,28H,9-10,14-15,17-20H2,1-5H3/t24-/m0/s1 |
| InChIKey | OJZOPDXHXFODIY-DEOSSOPVSA-N |
| XLogP | 5.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|