C29H36O6 — CID 139755556
1-O,2-O-dibenzyl 1-O-tert-butyl (2R)-3-cyclopentylpropane-1,1,2-tricarboxylate (PubChem CID 139755556) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-O,2-O-dibenzyl 1-O-tert-butyl (2R)-3-cyclopentylpropane-1,1,2-tricarboxylate.
| Compound Name | 1-O,2-O-dibenzyl 1-O-tert-butyl (2R)-3-cyclopentylpropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 139755556 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 1-O,2-O-dibenzyl 1-O-tert-butyl (2R)-3-cyclopentylpropane-1,1,2-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OCc1ccccc1)[C@@H](CC1CCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H36O6/c1-29(2,3)35-28(32)25(27(31)34-20-23-16-8-5-9-17-23)24(18-21-12-10-11-13-21)26(30)33-19-22-14-6-4-7-15-22/h4-9,14-17,21,24-25H,10-13,18-20H2,1-3H3/t24-,25?/m1/s1 |
| InChIKey | IPCWVILTNLSWLE-IKOFQBKESA-N |
| XLogP | 5.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|