C29H42N2O2 — CID 141276838
tert-butyl N-[(2S)-3-cyclohexyl-2-(dibenzylamino)propyl]-N-methylcarbamate (PubChem CID 141276838) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-cyclohexyl-2-(dibenzylamino)propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-3-cyclohexyl-2-(dibenzylamino)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 141276838 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | tert-butyl N-[(2S)-3-cyclohexyl-2-(dibenzylamino)propyl]-N-methylcarbamate |
| SMILES | CN(C[C@H](CC1CCCCC1)N(Cc1ccccc1)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H42N2O2/c1-29(2,3)33-28(32)30(4)23-27(20-24-14-8-5-9-15-24)31(21-25-16-10-6-11-17-25)22-26-18-12-7-13-19-26/h6-7,10-13,16-19,24,27H,5,8-9,14-15,20-23H2,1-4H3/t27-/m0/s1 |
| InChIKey | WWHQUFGYHLHHPK-MHZLTWQESA-N |
| XLogP | 6.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |