C15H23NO3 — CID 139793857
tert-butyl N-benzyl-N-(2-hydroxypropan-2-yl)carbamate (PubChem CID 139793857) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-(2-hydroxypropan-2-yl)carbamate.
| Compound Name | tert-butyl N-benzyl-N-(2-hydroxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 139793857 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | tert-butyl N-benzyl-N-(2-hydroxypropan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C15H23NO3/c1-14(2,3)19-13(17)16(15(4,5)18)11-12-9-7-6-8-10-12/h6-10,18H,11H2,1-5H3 |
| InChIKey | GNABITMUKLKQSV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|