C15H21F3N2O2 — CID 162549928
tert-butyl N-(2-amino-1,1,1-trifluoropropan-2-yl)-N-benzylcarbamate (PubChem CID 162549928) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is tert-butyl N-(2-amino-1,1,1-trifluoropropan-2-yl)-N-benzylcarbamate.
| Compound Name | tert-butyl N-(2-amino-1,1,1-trifluoropropan-2-yl)-N-benzylcarbamate |
|---|---|
| PubChem CID | 162549928 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl N-(2-amino-1,1,1-trifluoropropan-2-yl)-N-benzylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O2/c1-13(2,3)22-12(21)20(14(4,19)15(16,17)18)10-11-8-6-5-7-9-11/h5-9H,10,19H2,1-4H3 |
| InChIKey | SEQGHVFGTKKVRN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|