C18H26FNO5 — CID 122371939
ethyl (2R)-2-fluoro-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate (PubChem CID 122371939) has the molecular formula C18H26FNO5 and a molecular weight of 355.41 g/mol. Its IUPAC name is ethyl (2R)-2-fluoro-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-fluoro-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 122371939 |
| Molecular Formula | C18H26FNO5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | ethyl (2R)-2-fluoro-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@](F)(Cc1ccccc1)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26FNO5/c1-6-24-15(21)18(19,12-14-10-8-7-9-11-14)20(13-23-5)16(22)25-17(2,3)4/h7-11H,6,12-13H2,1-5H3/t18-/m0/s1 |
| InChIKey | CQCYQCMWCLGPKB-SFHVURJKSA-N |
| XLogP | 3.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|