C26H35NO6 — CID 102024392
3-(2-hydroxyphenyl)propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylpropanoate (PubChem CID 102024392) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylpropanoate.
| Compound Name | 3-(2-hydroxyphenyl)propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 102024392 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 3-(2-hydroxyphenyl)propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methyl-3-phenylpropanoate |
| SMILES | COCN(C(=O)OC(C)(C)C)[C@@](C)(Cc1ccccc1)C(=O)OCCCc1ccccc1O |
| InChI | InChI=1S/C26H35NO6/c1-25(2,3)33-24(30)27(19-31-5)26(4,18-20-12-7-6-8-13-20)23(29)32-17-11-15-21-14-9-10-16-22(21)28/h6-10,12-14,16,28H,11,15,17-19H2,1-5H3/t26-/m0/s1 |
| InChIKey | WBCAQTJSZPELGJ-SANMLTNESA-N |
| XLogP | 4.71 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|