C22H35NO6 — CID 139978763
2-(2-hydroxyphenyl)ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhexanoate (PubChem CID 139978763) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhexanoate.
| Compound Name | 2-(2-hydroxyphenyl)ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhexanoate |
|---|---|
| PubChem CID | 139978763 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-(2-hydroxyphenyl)ethyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylhexanoate |
| SMILES | CCCC[C@@](C)(C(=O)OCCc1ccccc1O)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35NO6/c1-7-8-14-22(5,23(16-27-6)20(26)29-21(2,3)4)19(25)28-15-13-17-11-9-10-12-18(17)24/h9-12,24H,7-8,13-16H2,1-6H3/t22-/m0/s1 |
| InChIKey | JKDYODKNNXXCOG-QFIPXVFZSA-N |
| XLogP | 4.27 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|