C16H31NO5 — CID 139916811
propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpentanoate (PubChem CID 139916811) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpentanoate.
| Compound Name | propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 139916811 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | propyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpentanoate |
| SMILES | CCCOC(=O)[C@](C)(CCC)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO5/c1-8-10-16(6,13(18)21-11-9-2)17(12-20-7)14(19)22-15(3,4)5/h8-12H2,1-7H3/t16-/m0/s1 |
| InChIKey | QNBAETDFTMNACK-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|