C23H34N2O5 — CID 139916798
butyl (2S)-3-(1H-indol-3-yl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate (PubChem CID 139916798) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is butyl (2S)-3-(1H-indol-3-yl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate.
| Compound Name | butyl (2S)-3-(1H-indol-3-yl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 139916798 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | butyl (2S)-3-(1H-indol-3-yl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate |
| SMILES | CCCCOC(=O)[C@](C)(Cc1c[nH]c2ccccc12)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N2O5/c1-7-8-13-29-20(26)23(5,25(16-28-6)21(27)30-22(2,3)4)14-17-15-24-19-12-10-9-11-18(17)19/h9-12,15,24H,7-8,13-14,16H2,1-6H3/t23-/m0/s1 |
| InChIKey | CCWRENOVEJSULY-QHCPKHFHSA-N |
| XLogP | 4.65 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|