C16H29NO5 — CID 139916814
(2S)-2-[(2S)-butan-2-yl]-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-4-enoic acid (PubChem CID 139916814) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is (2S)-2-[(2S)-butan-2-yl]-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-4-enoic acid.
| Compound Name | (2S)-2-[(2S)-butan-2-yl]-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 139916814 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (2S)-2-[(2S)-butan-2-yl]-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pent-4-enoic acid |
| SMILES | C=CC[C@@](C(=O)O)([C@@H](C)CC)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-8-10-16(13(18)19,12(3)9-2)17(11-21-7)14(20)22-15(4,5)6/h8,12H,1,9-11H2,2-7H3,(H,18,19)/t12-,16-/m0/s1 |
| InChIKey | RYJCUEFPMCLLDV-LRDDRELGSA-N |
| XLogP | 3.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|