C11H21NO5 — CID 139916802
methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 139916802) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 139916802 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | COCN(C(=O)OC(C)(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C11H21NO5/c1-8(9(13)16-6)12(7-15-5)10(14)17-11(2,3)4/h8H,7H2,1-6H3/t8-/m0/s1 |
| InChIKey | CSGHXWDUFCYTGH-QMMMGPOBSA-N |
| XLogP | 1.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|