C10H19N2O6S- — CID 167202325
2-[(1-amino-2-methoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethanesulfinate (PubChem CID 167202325) has the molecular formula C10H19N2O6S- and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[(1-amino-2-methoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethanesulfinate.
| Compound Name | 2-[(1-amino-2-methoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethanesulfinate |
|---|---|
| PubChem CID | 167202325 |
| Molecular Formula | C10H19N2O6S- |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[(1-amino-2-methoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethanesulfinate |
| SMILES | COC(=O)C(N)N(CCS(=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O6S/c1-10(2,3)18-9(14)12(5-6-19(15)16)7(11)8(13)17-4/h7H,5-6,11H2,1-4H3,(H,15,16)/p-1 |
| InChIKey | JECPJINSIKYASV-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|