C14H25NO5 — CID 88577515
methyl 3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-formylpentanoate (PubChem CID 88577515) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-formylpentanoate.
| Compound Name | methyl 3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-formylpentanoate |
|---|---|
| PubChem CID | 88577515 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | methyl 3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-formylpentanoate |
| SMILES | CCC(C(C=O)C(=O)OC)N(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO5/c1-7-11(10(9-16)12(17)19-6)15(8-2)13(18)20-14(3,4)5/h9-11H,7-8H2,1-6H3 |
| InChIKey | MFYWTZHXTOXBSB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|