C14H27NO5 — CID 139916813
methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoate (PubChem CID 139916813) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 139916813 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | methyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoate |
| SMILES | COCN(C(=O)OC(C)(C)C)[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C14H27NO5/c1-10(2)8-11(12(16)19-7)15(9-18-6)13(17)20-14(3,4)5/h10-11H,8-9H2,1-7H3/t11-/m0/s1 |
| InChIKey | NPIVLCKUGFBEIO-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|