C13H23NO7 — CID 169193333
dimethyl (2R,4S)-2-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate (PubChem CID 169193333) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is dimethyl (2R,4S)-2-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate.
| Compound Name | dimethyl (2R,4S)-2-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 169193333 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | dimethyl (2R,4S)-2-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate |
| SMILES | COC(=O)[C@H](O)C[C@@H](C(=O)OC)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO7/c1-13(2,3)21-12(18)14(4)8(10(16)19-5)7-9(15)11(17)20-6/h8-9,15H,7H2,1-6H3/t8-,9+/m0/s1 |
| InChIKey | MUFGPCBDODWYAU-DTWKUNHWSA-N |
| XLogP | 0.32 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|