C13H25NO5 — CID 166732577
methyl 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxypropanoate (PubChem CID 166732577) has the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. Its IUPAC name is methyl 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 166732577 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | methyl 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)N(C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO5/c1-12(2,3)14(9(8-15)10(16)18-7)11(17)19-13(4,5)6/h9,15H,8H2,1-7H3 |
| InChIKey | RRBZDUCEXBCDOG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |