C19H33NO8 — CID 11036865
methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[(2R,3R)-3-(hydroxymethyl)oxiran-2-yl]pentanoate (PubChem CID 11036865) has the molecular formula C19H33NO8 and a molecular weight of 403.47 g/mol. Its IUPAC name is methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[(2R,3R)-3-(hydroxymethyl)oxiran-2-yl]pentanoate.
| Compound Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[(2R,3R)-3-(hydroxymethyl)oxiran-2-yl]pentanoate |
|---|---|
| PubChem CID | 11036865 |
| Molecular Formula | C19H33NO8 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[(2R,3R)-3-(hydroxymethyl)oxiran-2-yl]pentanoate |
| SMILES | COC(=O)[C@H](CCC[C@H]1O[C@@H]1CO)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO8/c1-18(2,3)27-16(23)20(17(24)28-19(4,5)6)12(15(22)25-7)9-8-10-13-14(11-21)26-13/h12-14,21H,8-11H2,1-7H3/t12-,13+,14+/m0/s1 |
| InChIKey | FNCWTRPWMILPQN-BFHYXJOUSA-N |
| XLogP | 2.63 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|