C18H33N3O7 — CID 9209525
methyl (2S)-6-amino-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate (PubChem CID 9209525) has the molecular formula C18H33N3O7 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 9209525 |
| Molecular Formula | C18H33N3O7 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | methyl (2S)-6-amino-2-[[(4S)-4-amino-5-methoxy-5-oxopentanoyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate |
| SMILES | COC(=O)[C@@H](N)CCC(=O)N(C(=O)OC(C)(C)C)[C@@H](CCCCN)C(=O)OC |
| InChI | InChI=1S/C18H33N3O7/c1-18(2,3)28-17(25)21(13(16(24)27-5)8-6-7-11-19)14(22)10-9-12(20)15(23)26-4/h12-13H,6-11,19-20H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | FSMXFXZAJZBOBF-STQMWFEESA-N |
| XLogP | 0.70 |
| TPSA | 151.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|