C18H31NO7 — CID 87471363
methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-oxoheptanoate (PubChem CID 87471363) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-oxoheptanoate.
| Compound Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-oxoheptanoate |
|---|---|
| PubChem CID | 87471363 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-oxoheptanoate |
| SMILES | COC(=O)CCCC(C(C)=O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO7/c1-12(20)13(10-9-11-14(21)24-8)19(15(22)25-17(2,3)4)16(23)26-18(5,6)7/h13H,9-11H2,1-8H3 |
| InChIKey | TYTOGMARNQBLKT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|