About methyl 5-acetyldecanoate
methyl 5-acetyldecanoate (PubChem CID 101282210) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is methyl 5-acetyldecanoate.
Molecular Properties
| Compound Name | methyl 5-acetyldecanoate |
| PubChem CID | 101282210 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methyl 5-acetyldecanoate |
| SMILES | CCCCCC(CCCC(=O)OC)C(C)=O |
| InChI | InChI=1S/C13H24O3/c1-4-5-6-8-12(11(2)14)9-7-10-13(15)16-3/h12H,4-10H2,1-3H3 |
| InChIKey | PPDQCFYEQSRKOT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-acetyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyldecanoate?
The IUPAC name of methyl 5-acetyldecanoate (CID 101282210) is methyl 5-acetyldecanoate.
What is the SMILES notation for methyl 5-acetyldecanoate?
The canonical SMILES for methyl 5-acetyldecanoate is CCCCCC(CCCC(=O)OC)C(C)=O.
What is the InChIKey of methyl 5-acetyldecanoate?
The InChIKey is PPDQCFYEQSRKOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-4-5-6-8-12(11(2)14)9-7-10-13(15)16-3/h12H,4-10H2,1-3H3.
What are the key properties of methyl 5-acetyldecanoate?
methyl 5-acetyldecanoate has a molecular weight of 228.33 g/mol, XLogP of 3.12, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyldecanoate is sourced from PubChem (CID 101282210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).