About methyl 6-acetylnonanoate
methyl 6-acetylnonanoate (PubChem CID 101282206) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is methyl 6-acetylnonanoate.
Molecular Properties
| Compound Name | methyl 6-acetylnonanoate |
| PubChem CID | 101282206 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | methyl 6-acetylnonanoate |
| SMILES | CCCC(CCCCC(=O)OC)C(C)=O |
| InChI | InChI=1S/C12H22O3/c1-4-7-11(10(2)13)8-5-6-9-12(14)15-3/h11H,4-9H2,1-3H3 |
| InChIKey | BSQDITCHALNECD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-acetylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-acetylnonanoate?
The IUPAC name of methyl 6-acetylnonanoate (CID 101282206) is methyl 6-acetylnonanoate.
What is the SMILES notation for methyl 6-acetylnonanoate?
The canonical SMILES for methyl 6-acetylnonanoate is CCCC(CCCCC(=O)OC)C(C)=O.
What is the InChIKey of methyl 6-acetylnonanoate?
The InChIKey is BSQDITCHALNECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-4-7-11(10(2)13)8-5-6-9-12(14)15-3/h11H,4-9H2,1-3H3.
What are the key properties of methyl 6-acetylnonanoate?
methyl 6-acetylnonanoate has a molecular weight of 214.30 g/mol, XLogP of 2.73, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-acetylnonanoate is sourced from PubChem (CID 101282206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).