C17H29NO7 — CID 89252722
methyl (4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxohexanoate (PubChem CID 89252722) has the molecular formula C17H29NO7 and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl (4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxohexanoate.
| Compound Name | methyl (4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 89252722 |
| Molecular Formula | C17H29NO7 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | methyl (4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxohexanoate |
| SMILES | COC(=O)CC[C@@H](C(C)=O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO7/c1-11(19)12(9-10-13(20)23-8)18(14(21)24-16(2,3)4)15(22)25-17(5,6)7/h12H,9-10H2,1-8H3/t12-/m0/s1 |
| InChIKey | BCJFEUDDVZKXMT-LBPRGKRZSA-N |
| XLogP | 3.07 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|