C16H29NO5 — CID 164725863
tert-butyl 2-[acetyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate (PubChem CID 164725863) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is tert-butyl 2-[acetyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate.
| Compound Name | tert-butyl 2-[acetyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 164725863 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | tert-butyl 2-[acetyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
| SMILES | CCCC(C(=O)OC(C)(C)C)N(C(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-9-10-12(13(19)21-15(3,4)5)17(11(2)18)14(20)22-16(6,7)8/h12H,9-10H2,1-8H3 |
| InChIKey | IUFGDMCFTLJPAU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |