C23H41NO9 — CID 101202390
7-O-tert-butyl 1-O-ethyl (6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-hydroxyheptanedioate (PubChem CID 101202390) has the molecular formula C23H41NO9 and a molecular weight of 475.58 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl (6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-hydroxyheptanedioate.
| Compound Name | 7-O-tert-butyl 1-O-ethyl (6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-hydroxyheptanedioate |
|---|---|
| PubChem CID | 101202390 |
| Molecular Formula | C23H41NO9 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl (6S)-6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-hydroxyheptanedioate |
| SMILES | CCOC(=O)C(O)CCC[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41NO9/c1-11-30-18(27)16(25)14-12-13-15(17(26)31-21(2,3)4)24(19(28)32-22(5,6)7)20(29)33-23(8,9)10/h15-16,25H,11-14H2,1-10H3/t15-,16?/m0/s1 |
| InChIKey | HETKKGHSQUFGGP-VYRBHSGPSA-N |
| XLogP | 3.96 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|