C18H29F2NO7 — CID 72586938
ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-difluoro-6-hydroxyhex-4-enoate (PubChem CID 72586938) has the molecular formula C18H29F2NO7 and a molecular weight of 409.43 g/mol. Its IUPAC name is ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-difluoro-6-hydroxyhex-4-enoate.
| Compound Name | ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-difluoro-6-hydroxyhex-4-enoate |
|---|---|
| PubChem CID | 72586938 |
| Molecular Formula | C18H29F2NO7 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4,5-difluoro-6-hydroxyhex-4-enoate |
| SMILES | CCOC(=O)C(CC(F)=C(F)CO)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29F2NO7/c1-8-26-14(23)13(9-11(19)12(20)10-22)21(15(24)27-17(2,3)4)16(25)28-18(5,6)7/h13,22H,8-10H2,1-7H3 |
| InChIKey | OSUSYUQNFVAYCK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|