About tert-butyl (2R)-2-hydroxypentanoate
tert-butyl (2R)-2-hydroxypentanoate (PubChem CID 90988150) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is tert-butyl (2R)-2-hydroxypentanoate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-hydroxypentanoate |
| PubChem CID | 90988150 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | tert-butyl (2R)-2-hydroxypentanoate |
| SMILES | CCC[C@@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18O3/c1-5-6-7(10)8(11)12-9(2,3)4/h7,10H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | MZPPRWQFUAKFRD-SSDOTTSWSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2R)-2-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-hydroxypentanoate?
The IUPAC name of tert-butyl (2R)-2-hydroxypentanoate (CID 90988150) is tert-butyl (2R)-2-hydroxypentanoate.
What is the SMILES notation for tert-butyl (2R)-2-hydroxypentanoate?
The canonical SMILES for tert-butyl (2R)-2-hydroxypentanoate is CCC[C@@H](O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-hydroxypentanoate?
The InChIKey is MZPPRWQFUAKFRD-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H18O3/c1-5-6-7(10)8(11)12-9(2,3)4/h7,10H,5-6H2,1-4H3/t7-/m1/s1.
What are the key properties of tert-butyl (2R)-2-hydroxypentanoate?
tert-butyl (2R)-2-hydroxypentanoate has a molecular weight of 174.24 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-hydroxypentanoate is sourced from PubChem (CID 90988150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).