C12H20O5 — CID 10562250
1-O-tert-butyl 5-O-prop-2-enyl (2R)-2-hydroxypentanedioate (PubChem CID 10562250) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-prop-2-enyl (2R)-2-hydroxypentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-prop-2-enyl (2R)-2-hydroxypentanedioate |
|---|---|
| PubChem CID | 10562250 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-O-tert-butyl 5-O-prop-2-enyl (2R)-2-hydroxypentanedioate |
| SMILES | C=CCOC(=O)CC[C@@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20O5/c1-5-8-16-10(14)7-6-9(13)11(15)17-12(2,3)4/h5,9,13H,1,6-8H2,2-4H3/t9-/m1/s1 |
| InChIKey | XOQZKYQKVKGHGS-SECBINFHSA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|