C12H22NO4+ — CID 7015064
[(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-prop-2-enoxypentan-2-yl]azanium (PubChem CID 7015064) has the molecular formula C12H22NO4+ and a molecular weight of 244.31 g/mol. Its IUPAC name is [(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-prop-2-enoxypentan-2-yl]azanium.
| Compound Name | [(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-prop-2-enoxypentan-2-yl]azanium |
|---|---|
| PubChem CID | 7015064 |
| Molecular Formula | C12H22NO4+ |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(2S)-5-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-1-prop-2-enoxypentan-2-yl]azanium |
| SMILES | C=CCOC(=O)[C@@H]([NH3+])CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO4/c1-5-8-16-11(15)9(13)6-7-10(14)17-12(2,3)4/h5,9H,1,6-8,13H2,2-4H3/p+1/t9-/m0/s1 |
| InChIKey | NXCBQSGSQJTRJK-VIFPVBQESA-O |
| XLogP | 0.45 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|