C18H31NO5 — CID 143896016
tert-butyl (4S)-4-methyl-5-[[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl]amino]-5-oxopentanoate (PubChem CID 143896016) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl (4S)-4-methyl-5-[[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (4S)-4-methyl-5-[[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 143896016 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | tert-butyl (4S)-4-methyl-5-[[(2S)-3-methyl-1-oxo-1-prop-2-enoxybutan-2-yl]amino]-5-oxopentanoate |
| SMILES | C=CCOC(=O)[C@@H](NC(=O)[C@@H](C)CCC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H31NO5/c1-8-11-23-17(22)15(12(2)3)19-16(21)13(4)9-10-14(20)24-18(5,6)7/h8,12-13,15H,1,9-11H2,2-7H3,(H,19,21)/t13-,15-/m0/s1 |
| InChIKey | VQFLVKQSSCWWNY-ZFWWWQNUSA-N |
| XLogP | 2.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|