C28H41N3O8 — CID 135202310
prop-2-enyl 3-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]pentanoate (PubChem CID 135202310) has the molecular formula C28H41N3O8 and a molecular weight of 547.65 g/mol. Its IUPAC name is prop-2-enyl 3-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | prop-2-enyl 3-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 135202310 |
| Molecular Formula | C28H41N3O8 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | prop-2-enyl 3-methyl-2-[[(2S)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoyl]amino]pentanoate |
| SMILES | C=CCOC(=O)C(NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)CNC(=O)OCc1ccccc1)C(C)CC |
| InChI | InChI=1S/C28H41N3O8/c1-7-16-37-26(35)24(19(3)8-2)31-25(34)21(14-15-23(33)39-28(4,5)6)30-22(32)17-29-27(36)38-18-20-12-10-9-11-13-20/h7,9-13,19,21,24H,1,8,14-18H2,2-6H3,(H,29,36)(H,30,32)(H,31,34)/t19?,21-,24?/m0/s1 |
| InChIKey | COVJHCMADHOYGU-MMPATGFWSA-N |
| XLogP | 2.78 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|