C25H35N3O8 — CID 134322954
tert-butyl (4S)-5-oxo-5-[(2-oxo-2-prop-2-enoxyethyl)amino]-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate (PubChem CID 134322954) has the molecular formula C25H35N3O8 and a molecular weight of 505.57 g/mol. Its IUPAC name is tert-butyl (4S)-5-oxo-5-[(2-oxo-2-prop-2-enoxyethyl)amino]-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate.
| Compound Name | tert-butyl (4S)-5-oxo-5-[(2-oxo-2-prop-2-enoxyethyl)amino]-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 134322954 |
| Molecular Formula | C25H35N3O8 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | tert-butyl (4S)-5-oxo-5-[(2-oxo-2-prop-2-enoxyethyl)amino]-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
| SMILES | C=CCOC(=O)CNC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H35N3O8/c1-6-14-34-21(30)15-26-23(32)19(12-13-20(29)36-25(3,4)5)28-22(31)17(2)27-24(33)35-16-18-10-8-7-9-11-18/h6-11,17,19H,1,12-16H2,2-5H3,(H,26,32)(H,27,33)(H,28,31)/t17-,19-/m0/s1 |
| InChIKey | RBGRKCFCVYWFSB-HKUYNNGSSA-N |
| XLogP | 1.75 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|