C29H30N2O7 — CID 3104557
dibenzyl 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanedioate (PubChem CID 3104557) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is dibenzyl 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanedioate.
| Compound Name | dibenzyl 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 3104557 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | dibenzyl 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanedioate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NC(CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H30N2O7/c32-26(18-30-29(35)38-21-24-14-8-3-9-15-24)31-25(28(34)37-20-23-12-6-2-7-13-23)16-17-27(33)36-19-22-10-4-1-5-11-22/h1-15,25H,16-21H2,(H,30,35)(H,31,32) |
| InChIKey | VQGFHUMSSSAJLJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|