C18H25N2O6S+ — CID 44590163
[(5S)-5-carboxy-2-oxo-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentyl]-dimethylsulfanium (PubChem CID 44590163) has the molecular formula C18H25N2O6S+ and a molecular weight of 397.47 g/mol. Its IUPAC name is [(5S)-5-carboxy-2-oxo-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentyl]-dimethylsulfanium.
| Compound Name | [(5S)-5-carboxy-2-oxo-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 44590163 |
| Molecular Formula | C18H25N2O6S+ |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [(5S)-5-carboxy-2-oxo-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentyl]-dimethylsulfanium |
| SMILES | C[S+](C)CC(=O)CC[C@H](NC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H24N2O6S/c1-27(2)12-14(21)8-9-15(17(23)24)20-16(22)10-19-18(25)26-11-13-6-4-3-5-7-13/h3-7,15H,8-12H2,1-2H3,(H2-,19,20,22,23,24,25)/p+1/t15-/m0/s1 |
| InChIKey | ZREUNCMKLVTPBD-HNNXBMFYSA-O |
| XLogP | 0.71 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|