C20H27BrN2O8S — CID 44589526
[(5S)-5-carboxy-5-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-oxopentyl]-dimethylsulfanium bromide (PubChem CID 44589526) has the molecular formula C20H27BrN2O8S and a molecular weight of 535.41 g/mol. Its IUPAC name is [(5S)-5-carboxy-5-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-oxopentyl]-dimethylsulfanium bromide.
| Compound Name | [(5S)-5-carboxy-5-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-oxopentyl]-dimethylsulfanium bromide |
|---|---|
| PubChem CID | 44589526 |
| Molecular Formula | C20H27BrN2O8S |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | [(5S)-5-carboxy-5-[[(2S)-3-carboxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-2-oxopentyl]-dimethylsulfanium bromide |
| SMILES | C[S+](C)CC(=O)CC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1)C(=O)O.[Br-] |
| InChI | InChI=1S/C20H26N2O8S.BrH/c1-31(2)12-14(23)8-9-15(19(27)28)21-18(26)16(10-17(24)25)22-20(29)30-11-13-6-4-3-5-7-13;/h3-7,15-16H,8-12H2,1-2H3,(H3-,21,22,24,25,26,27,28,29);1H/t15-,16-;/m0./s1 |
| InChIKey | VTJOBOQLXQPCMN-MOGJOVFKSA-N |
| XLogP | -2.44 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|