C18H23BrN2O7 — CID 142977974
6-bromo-2-[[3-methoxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-5-oxohexanoic acid (PubChem CID 142977974) has the molecular formula C18H23BrN2O7 and a molecular weight of 459.29 g/mol. Its IUPAC name is 6-bromo-2-[[3-methoxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-5-oxohexanoic acid.
| Compound Name | 6-bromo-2-[[3-methoxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 142977974 |
| Molecular Formula | C18H23BrN2O7 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 6-bromo-2-[[3-methoxy-2-(phenylmethoxycarbonylamino)propanoyl]amino]-5-oxohexanoic acid |
| SMILES | COCC(NC(=O)OCc1ccccc1)C(=O)NC(CCC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C18H23BrN2O7/c1-27-11-15(21-18(26)28-10-12-5-3-2-4-6-12)16(23)20-14(17(24)25)8-7-13(22)9-19/h2-6,14-15H,7-11H2,1H3,(H,20,23)(H,21,26)(H,24,25) |
| InChIKey | RITOQXHQHONEQH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|