C17H21BrN2O6 — CID 91136664
(2S)-6-bromo-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid (PubChem CID 91136664) has the molecular formula C17H21BrN2O6 and a molecular weight of 429.27 g/mol. Its IUPAC name is (2S)-6-bromo-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-bromo-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 91136664 |
| Molecular Formula | C17H21BrN2O6 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (2S)-6-bromo-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]hexanoic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C17H21BrN2O6/c1-11(19-17(25)26-10-12-5-3-2-4-6-12)15(22)20-14(16(23)24)8-7-13(21)9-18/h2-6,11,14H,7-10H2,1H3,(H,19,25)(H,20,22)(H,23,24)/t11-,14-/m0/s1 |
| InChIKey | MFJIHCBJHCJYQX-FZMZJTMJSA-N |
| XLogP | 1.61 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|