C22H33N3O6S — CID 11363345
2-[[6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-dimethylsulfonio-5-oxohexanoate (PubChem CID 11363345) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[[6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-dimethylsulfonio-5-oxohexanoate.
| Compound Name | 2-[[6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-dimethylsulfonio-5-oxohexanoate |
|---|---|
| PubChem CID | 11363345 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-[[6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-6-dimethylsulfonio-5-oxohexanoate |
| SMILES | C[S+](C)CC(=O)CCC(NC(=O)C(CCCCN)NC(=O)OCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C22H33N3O6S/c1-32(2)15-17(26)11-12-19(21(28)29)24-20(27)18(10-6-7-13-23)25-22(30)31-14-16-8-4-3-5-9-16/h3-5,8-9,18-19H,6-7,10-15,23H2,1-2H3,(H2-,24,25,27,28,29,30) |
| InChIKey | INITXPYKORWYEL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|