C34H37N3O9 — CID 58088391
dibenzyl (2S)-2-[[(2S,4R)-4-hydroxy-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioate (PubChem CID 58088391) has the molecular formula C34H37N3O9 and a molecular weight of 631.68 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[(2S,4R)-4-hydroxy-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[(2S,4R)-4-hydroxy-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 58088391 |
| Molecular Formula | C34H37N3O9 |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | dibenzyl (2S)-2-[[(2S,4R)-4-hydroxy-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanedioate |
| SMILES | O=C(CC[C@H](NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)CNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H37N3O9/c38-27-18-29(37(20-27)30(39)19-35-34(43)46-23-26-14-8-3-9-15-26)32(41)36-28(33(42)45-22-25-12-6-2-7-13-25)16-17-31(40)44-21-24-10-4-1-5-11-24/h1-15,27-29,38H,16-23H2,(H,35,43)(H,36,41)/t27-,28+,29+/m1/s1 |
| InChIKey | VLGMJIMFFPBGMV-ULNSLHSMSA-N |
| XLogP | 2.63 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|