C16H22N2O4 — CID 59347253
benzyl N-[2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoethyl]carbamate (PubChem CID 59347253) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is benzyl N-[2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 59347253 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | benzyl N-[2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoethyl]carbamate |
| SMILES | CCC1CN(C(=O)CNC(=O)OCc2ccccc2)CC1O |
| InChI | InChI=1S/C16H22N2O4/c1-2-13-9-18(10-14(13)19)15(20)8-17-16(21)22-11-12-6-4-3-5-7-12/h3-7,13-14,19H,2,8-11H2,1H3,(H,17,21) |
| InChIKey | BULIVVHXUBQILX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |