C19H26N2O5S — CID 90593963
benzyl N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]carbamate (PubChem CID 90593963) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is benzyl N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 90593963 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | benzyl N-[2-(3-cyclohexylsulfonylazetidin-1-yl)-2-oxoethyl]carbamate |
| SMILES | O=C(NCC(=O)N1CC(S(=O)(=O)C2CCCCC2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O5S/c22-18(11-20-19(23)26-14-15-7-3-1-4-8-15)21-12-17(13-21)27(24,25)16-9-5-2-6-10-16/h1,3-4,7-8,16-17H,2,5-6,9-14H2,(H,20,23) |
| InChIKey | FDHVWULQOGPEGQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |